Name: 
 

Chemistry 12 - Unit 1 Quiz



True/False
Indicate whether the sentence or statement is true or false.
 

1. 

Carbonyl groups are present in alcohols, ethers, aldehydes, ketones, and esters.
 

2. 

When a primary alcohol is mildly oxidized, an aldehyde is produced; when a secondary alcohol is mildly oxidized, a ketone is produced.
 

3. 

The formation of an alcohol when an alkene reacts with water in the presence of an acid is an example of a hydrolysis reaction.
 

4. 

Benzene reacts readily with bromine in addition reactions at its double bonds.
 

5. 

When methanol and vinegar are allowed to react, ethyl methanoate and water are produced from the esterification reaction.
 

6. 

Diethylether is a structural isomer of 2-butanol, and hexanal is a structural isomer of 3-hexanone.
 

7. 

1,2-dibromoethane can be produced from the substitution reaction of bromine with ethene.
 

8. 

Polybutene is formed from addition reaction of butene monomers, and the polymer chain consists of carbon atoms single bonded to each other, with ethyl groups attached to each carbon atom in the chain.
 

9. 

Condensation polymers such as polystyrene and polypropylene may have physical properties such as flexibility and strength as a result of the degree of crosslinkages present in the polymer.
 

10. 

In proteins, the amino acid monomers are held together by amide linkages between the amino group of one amino acid to the carboxyl group of the adjacent amino acid.
 

Multiple Choice
Identify the letter of the choice that best completes the statement or answers the question.
 

11. 

What is the name of the compound whose structure is shown below?
c12-u1_files/i0130000.jpg
a.
2-aminopentane
b.
2-nitropentane
c.
ethylpropylamide
d.
ethylpropylamine
e.
pentylamino acid
 

12. 

What is the name of the compound whose structure is shown below?
c12-u1_files/i0140000.jpg
a.
3-amino-5-bromo-2,2-diethylheptane
b.
3-amino-5-bromo-2,6-diethylheptane
c.
3-bromo-5-amino-2,6-diethylheptane
d.
4-amino-6-bromo-3,7-diethyloctane
e.
4-amino-6-bromo-3,7-dimethylnonane
 

13. 

A compound belonging to the organic family of aromatic compounds is
a.
an aldehyde or a ketone with a distinctive odour.
b.
a compound containing a benzene ring in its structure.
c.
a compound containing a cyclic structure.
d.
a compound containing a cyclic structure with a double bond.
e.
an ester with a pleasant aroma.
 

14. 

Which of the following is NOT a correct description of the structure shown below:
c12-u1_files/i0160000.jpg
a.
an organic solvent
b.
methylbenzene
c.
phenylmethane
d.
toluene
e.
vanillin
 

15. 

What is the compound whose structure is shown?
c12-u1_files/i0170000.jpg
a.
a nucleotide
b.
a product of a saponification reaction
c.
a saturated fatty acid
d.
a triglyceride
e.
an unsaturated fatty acid
 

16. 

The formula of acetone is
a.
CH3CHO
b.
CH3OCH3
c.
CH3COCH3
d.
CH3COOCH3
e.
CH3CH2COOH
 

17. 

Of the following compounds, which has the highest solubility in water?
a.
CH3CH2CH=CHCH3
b.
c12-u1_files/i0190000.jpg
c.
c12-u1_files/i0190001.jpg
d.
c12-u1_files/i0190002.jpg
e.
c12-u1_files/i0190003.jpg
 

18. 

The formula for methyl acetate is:
a.
CH3CH2COCH3
b.
CH3COOCH2CH3
c.
CH3CH2OOCH2CH3
d.
CH3COOCH3
e.
CH3CHOHCH3
 

19. 

When 1-butene undergoes a hydration reaction, the product is
a.
1-butanal
b.
1-butanol
c.
2-butanal
d.
2-butanol
e.
2-butanone
 

20. 

The amide represented by the structural formula
c12-u1_files/i0220000.jpg
can be synthesized from
a.
acetic acid and a secondary amine
b.
ethanoic acid and a primary amine
c.
ethanoic acid and a tertiary amine
d.
formic acid and a secondary amine
e.
methanoic acid and a primary amine
 

21. 

Of the following compounds — aldehyde, amide, carboxylic acid, ester, ketone — all of analogous size, the compound with the highest boiling point is the
a.
aldehyde
b.
amide
c.
carboxylic acid
d.
ester
e.
ketone
 

22. 

Which of the following compounds is an ether?
a.
c12-u1_files/i0240000.jpg
b.
c12-u1_files/i0240001.jpg
c.
CH3CH(OH)CH3
d.
CH3CH2CH2OCH3
e.
CH3CH2COOCH3
 

23. 

A monomer of an addition polymer must
a.
contain a carboxyl group
b.
contain a double bond at each end of the monomer
c.
contain at least one double bond
d.
react to form crosslinkages
e.
react to form an ester
 

24. 

The polymer produced from the polymerization of H2NCH2COOH is
a.
[—COONHCH2CH2COO—]n
b.
[—HNCH2CONHCH2CO—]n
c.
[—HNCH2COOCCH2NH—]n
d.
[—HNCOCH2OCNH—]n
e.
[—OOCH2NHOOCH2—]n
 

25. 

Deoxyribonucleic acid, DNA, is a polymer made up of monomers
a.
linked in the polymer chain by amide linkages
b.
linked in the polymer chain by hydrogen bonds
c.
of glucose units
d.
of nucleic acids
e.
of nucleotides
 

26. 

The compound whose formula is CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH
a.
is a fat at ordinary room temperatures
b.
is an oil at ordinary room temperatures
c.
will undergo a hydrolysis reaction to form an oil
d.
will undergo an addition reaction to form a polysaccharide with glycerol
e.
will undergo an esterification reaction to form a triglyceride with glycerol
 



 
Check Your Work     Reset Help